Oxolinic acid sodium salt
Oxolinic acid sodium salt is a special medicine for aquatic products. It can be used to prevent and treat sarcoidosis of yellowtail, red sea bream, horse mackerel, tilapia, coho salmon, trout, rose salmon boils, vibriosis, carp bacterial sepsis, enteritis Diseases, channel catfish intestinal sepsis, eel red fin disease, red spot disease, Japanese shrimp vibriosis, Ayomonas infection, etc.
| Supplier | BOC Sciences |
|---|---|
| Product # | 59587-08-5 |
| Pricing | Inquire |
| Cas | 59587-08-5 |
| Molecular Weight | 283.21 |
| Molecular Formula | C13H10NNaO5 |
| Canonical SMILES | CCN1C=C(C(=O)C2=CC3=C(C=C21)OCO3)C(=O)[O-].[Na+] |