3-Amino-3-deoxy-D-mannose HCl
3-Amino-3-deoxy-D-mannose HCl, hailed as a paramount entity in the realm of biomedicine, emanates multifaceted prowess. Regarded primarily for its pharmacological contributions, it assumes a pivotal role in alleviating an array of ailments. Esteemed for its potent antimicrobial attributes, it stands as a prospective elixir, spearheading the relentless battle against pernicious microbial invasions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 69880-85-9 |
| Pricing | Inquire |
| Cas | 69880-85-9 |
| Molecular Weight | 215.63 |
| Molecular Formula | C6H14ClNO5 |
| Canonical SMILES | C(C(C(C(C(C=O)O)N)O)O)O.Cl |