rac Ramelteon-[d3]
Rac Ramelteon-[d3] is a labelled compound of rac Ramelteon. Ramelteon is a sleep agent medication that selectively binds to the MT1 and MT2 receptors in the suprachiasmatic nucleus (SCN), instead of binding to GABAA receptors, such as with drugs like zolpidem.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004039 |
| Pricing | Inquire |
| Cas | 1185146-24-0 |
| Molecular Weight | 262.36 |
| Molecular Formula | C16H18D3NO2 |
| Canonical SMILES | CCC(=O)NCCC1CCC2=C1C3=C(C=C2)OCC3 |