Verapamil Impurity M
An impurity of Verapamil. Verapamil is a medication used for the treatment of high blood pressure, chest pain from not enough blood flow to the heart, and supraventricular tachycardia.
| Supplier | BOC Sciences |
|---|---|
| Product # | 141991-89-1 |
| Pricing | Inquire |
| Cas | 141991-89-1 |
| Molecular Weight | 699.94 |
| Molecular Formula | C42H57N3O6 |
| Canonical SMILES | CC(C)C(CCCN(CCCC(C#N)(C1=CC(=C(C=C1)OC)OC)C(C)C)CCC2=CC(=C(C=C2)OC)OC)(C#N)C3=CC(=C(C=C3)OC)OC |