UDP-(3-O-(R-3-hydroxydecanoyl)) N-acetylglucosamine
UDP-(3-O-(R-3-hydroxydecanoyl)) N-acetylglucosamine is an indispensable compound, assuming a critical function in the synthetic pathway of lipid A, a fundamental constituent of bacterial lipopolysaccharides. Its application within the realm of microbial pathogenesis research is extensive, particularly in elucidating the intricate mechanisms underlying lipopolysaccharide biosynthesis and in identifying prospective drug targets to confront pernicious bacterial infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 953426-26-1 |
| Pricing | Inquire |
| Cas | 953426-26-1 |
| Molecular Weight | 777.60 |
| Molecular Formula | C27H45N3O19P2 |
| Canonical SMILES | CCCCCCCC(CC(=O)OC1C(C(OC(C1O)CO)OP(=O)(O)OP(=O)(O)OCC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O)NC(=O)C)O |