CHLOROPHYLL
| Supplier | CD Formulation |
|---|---|
| Product # | CDF4-0020 |
| CAS # | 215-800-7 |
| Pricing | 1 kg, Inquire for price |
| Image | 1406-65-1 |
| product1 | Food Ingredients |
| Molecular Formula | C54H69MgN4O5R+2 |
| Application | chlorophyll is used as a natural coloring agent. It is credited with skin-soothing and healing properties thanks to its phytol content, and has a mild deodorizing effect. Chlorophyll is the green coloring matter found in all living plants and seen in plant leaves. |
| Molecular Weight (g/mol) | 878.45446 |
| Synonyms | c.i.1956;chlorofolin;chlorofyl;Chlorophyl;chlorophylls;Chromule;deodophyll |
| CAS Number | 1406-65-1 |
| Category | Color Fixative |
| InChI Key | ATNHDLDRLWWWCB-UHFFFAOYSA-M |
| Purity | 0.99 |
| SMILES | CCC1=C(C2=NC1=CC3=C(C4=C(C(C(=C4[N-]3)C5=NC(=CC6=NC(=C2)C(=C6C)C=C)C(C5CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C)C(=O)OC)[O-])C)C.[Mg+2] |
| InChI | 1S/C55H73N4O5.Mg/c1-13-39-35(8)42-28-44-37(10)41(24-25-48(60)64-27-26-34(7)23-17-22-33(6)21-16-20-32(5)19-15-18-31(3)4)52(58-44)50-51(55(62)63-12)54(61)49-38(11)45(59-53(49)50)30-47-40(14-2)36(9)43(57-47)29-46(39)56-42;/h13,26,28-33,37,41,51H,1,14-25,27H2,2-12H3,(H-,56,57,58,59,61);/q-1;+2/p-1 |
| RTECS | FW6420000 |