N3-Methyl-5-methyluridine
N3-Methyl-5-methyluridine is a remarkable and pivotal compound extensively employed in the biomedical industry for the research of prominent viral ailments such as hepatitis C. This exceptional nucleoside analog executes its inhibition by diligently suppressing viral replication. Its mechanism of action centers around intricately thwarting viral RNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3650-91-7 |
| Pricing | Inquire |
| Cas | 3650-91-7 |
| Molecular Weight | 272.25 |
| Molecular Formula | C11H16N2O6 |
| Canonical SMILES | CC1=CN(C(=O)N(C1=O)C)C2C(C(C(O2)CO)O)O |