PA-46101 B
PA-46101 B is a macrolide antibiotic isolated from the culture broth of Streptomyces sp. PA-46101. It is active in vitro against anaerobic Gram-positive and Gram-negative bacteria and also against a limited number of aerobic Gram-positive bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03328 |
| Pricing | Inquire |
| Cas | 130812-34-9 |
| Molecular Weight | 1171.3 |
| Molecular Formula | C61H86O22 |
| Canonical SMILES | CCC1CC23C(=C(C(=O)O2)OC(=O)C4(C5CCC(C(C5C=C(C4CCCCC3(C=C1C(=O)O)C)C)OC6C(C(C(C(O6)C)OC(=O)C7=C(C=CC=C7OC)C)OC8CC(C(C(O8)C)OC)O)O)OC9C(C(C(C(O9)C)OC)(C)O)OC)C)O |