UDP-a-D-galactose
UDP-a-D-galactose is a pivotal nucleotide sugar molecule crucial for biosynthesizing carbohydrates and galactose-containing polysaccharides. Its active involvement in the biosynthesis of glycosphingolipids, the building blocks of cell membranes, makes it indispensable. Any impairment of this molecule might trigger galactosemia and other ailments, accentuating its contribution to cellular homeostasis.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2706-178577 |
| Pricing | Inquire |
| Cas | 2956-16-3 |
| Molecular Weight | 566.30 |
| Molecular Formula | C15H24N2O17P2 |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OC3C(C(C(C(O3)CO)O)O)O)O)O |