2-Amino-4-methyl-5-nitropyridine
2-Amino-4-methyl-5-nitropyridine (CAS# 21901-40-6) is chemical in the synthesis of drugs as new amides based on arachdonic-acid, with potential anti-inflammatory activity. Also is used in the preparation of novel benzylamine analogues of anacardic acid as antibacterial agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | 21901-40-6 |
| Pricing | Inquire |
| Cas | 21901-40-6 |
| Molecular Weight | 153.14 |
| Molecular Formula | C6H7N3O2 |
| Canonical SMILES | CC1=CC(=NC=C1[N+](=O)[O-])N |