3,5-Di-tert-butyl-2-hydroxybenzaldehyde
3,5-Di-tert-butyl-2-hydroxybenzaldehyde (CAS# 37942-07-7) is a salicylaldehyde derivative with antibacterial activity used in the preparation nickel complexes. 3,5-Di-t-butyl-2-hydroxybenzaldehyde is structurally related to 3,5-di-t-butylcatechol (DTCAT) but is not as potent an activator of rat skeletal muscle ryanodine receptor Ca2+ channel (RyRC).
| Supplier | BOC Sciences |
|---|---|
| Product # | 37942-07-7 |
| Pricing | Inquire |
| Cas | 37942-07-7 |
| Molecular Weight | 234.33 |
| Molecular Formula | C15H22O2 |
| Canonical SMILES | CC(C)(C)C1=CC(=C(C(=C1)C=O)O)C(C)(C)C |