(S)-1-Boc-3-hydroxypiperidine
(S)-1-Boc-3-hydroxypiperidine is a piperidine derivative with an amine protecting group used in the preparation of biologically active compounds such as antagonists of the human P2X7 receptor and selective irreversible inhibitors for bruton's tyrosine kinase.
| Supplier | BOC Sciences |
|---|---|
| Product # | 143900-44-1 |
| Pricing | Inquire |
| Cas | 143900-44-1 |
| Molecular Weight | 201.27 |
| Molecular Formula | C10H19NO3 |
| Canonical SMILES | CC(C)(C)OC(=O)N1CCCC(C1)O |