A 841720
A 841720 is a potent non-competitive mGlu1 receptor antagonist (IC50 = 10 nM) exhibiting 34-fold selectivity over mGluR5 and inactive to other mGluR receptors, neurotransmitter receptors, ion channels, and transporters. It inhibits complete Freund's adjuvant-induced inflammatory pain (ED50 = 23 µmol/kg) and decreases mechanical allodynia (ED50 = 28 µmol/kg) in mouse models.
| Supplier | BOC Sciences |
|---|---|
| Product # | 869802-58-4 |
| Pricing | Inquire |
| Cas | 869802-58-4 |
| Molecular Weight | 343.45 |
| Molecular Formula | C17H21N5OS |
| Canonical SMILES | CN(C)C1=C2C3=C(C(=O)N(C=N3)N4CCCCCC4)SC2=NC=C1 |