Ramelteon Impurity 14
Ramelteon Impurity 14 is an impurity of Ramelteon. Ramelteon is a potent and selective agonist at melatonin MT1/MT2 receptor. Ramelteon is a sleep agent medication used to treat sleeplessness (insomnia).
| Supplier | BOC Sciences |
|---|---|
| Product # | 326793-94-6 |
| Pricing | Inquire |
| Cas | 326793-94-6 |
| Molecular Weight | 245.32 |
| Molecular Formula | C15H19NO2 |
| Canonical SMILES | CC(=O)NCCC1CCC2=C1C3=C(C=C2)OCC3 |