Menin-MLL inhibitor 19
Menin-MLL inhibitor 19, a potent exo-aza spiro inhibitor of menin-MLL interaction, is used in the study of various diseases, such as cancer, myelodysplastic syndrome (MDS) and diabetes. (Extracted from patent WO2019120209A1, example A17)
| Supplier | BOC Sciences |
|---|---|
| Product # | 2360487-93-8 |
| Pricing | Inquire |
| Cas | 2360487-93-8 |
| Molecular Weight | 645.70 |
| Molecular Formula | C30H34F3N7O4S |
| Canonical SMILES | CC(C)(C)OC(=O)N(CC1=CC2=C(C=C1)N(C(=O)N2)CC(=O)N)C3CCC4(C3)CN(C4)C5=C6C=C(SC6=NC=N5)CC(F)(F)F |