1-(2,4-dihydroxyphenyl)-2-(4-hydroxyphenyl)propan-1-one
1-(2,4-dihydroxyphenyl)-2-(4-hydroxyphenyl)propan-1-one:
Deployed within the biomedical sector due to its promising antioxidant capabilities in addressing inflammatory ailments and combating cancerous growths.
Deployed within the biomedical sector due to its promising antioxidant capabilities in addressing inflammatory ailments and combating cancerous growths.
| Supplier | BOC Sciences |
|---|---|
| Product # | 21255-69-6 |
| Pricing | Inquire |
| Cas | 21255-69-6 |
| Molecular Weight | 258.269 |
| Molecular Formula | C15H14O4 |
| Canonical SMILES | CC(C1=CC=C(C=C1)O)C(=O)C2=C(C=C(C=C2)O)O |