6-Maleimidocaproic acid
6-Maleimidocaproic acid can be used as a spacer group to construct drugs and other types of biological conjugals. 6-maleimide hexanoic acid and N-hydroxysuccinimide were used as bifunctional cross-linking reagent. It can also be used as a probe for mercaptan group (SH-group) in membrane protein.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-006296 |
| Pricing | Inquire |
| Cas | 55750-53-3 |
| Molecular Weight | 211.21 |
| Molecular Formula | C10H13NO4 |
| Canonical SMILES | C1=CC(=O)N(C1=O)CCCCCC(=O)O |