2-Hydroxypropyl 2-(4-Isobutylphenyl)Propanoate
2-Hydroxypropyl 2-(4-Isobutylphenyl)Propanoate is a pharmaceutically significant compound, emerging as a pivotal agent employed for the research of intricate inflammatory ailments and the proficient regulation of agony. It acts as a NSAID.
| Supplier | BOC Sciences |
|---|---|
| Product # | 95093-58-6 |
| Pricing | Inquire |
| Cas | 95093-58-6 |
| Molecular Weight | 264.37 |
| Molecular Formula | C16H24O3 |
| Canonical SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)OCC(C)O |