Ezetimibe Tetrahydropyran Impurity
An impurity of Ezetimibe. Ezetimibe inhibits intestinal cholesterol absorption by preventing cholesterol uptake by the Niemann-Pick C1-like 1 (NPC1L1) protein, a cholesterol transporter located in the apical membrane of enterocytes.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0026-471373 |
| Pricing | Inquire |
| Cas | 1296129-15-1 |
| Molecular Weight | 409.44 |
| Molecular Formula | C24H21F2NO3 |
| Canonical SMILES | C1CC(OC(C1C(=O)NC2=CC=C(C=C2)F)C3=CC=C(C=C3)O)C4=CC=C(C=C4)F |