Atorvastatin N-(3,5-Dihydroxy-7-heptanoic Acid)amide
Atorvastatin N-(3,5-Dihydroxy-7-heptanoic Acid)amide is a prominent compound in the research of dyslipidemia and associated cardiovascular disorders. Its efficacious mechanism of action lies in its tremendous capacity to inhibit HMG-CoA reductase, a pivotal enzyme profoundly engaged in the intricate process of cholesterol biosynthesis.
Supplier | BOC Sciences |
---|---|
Product # | B0190-258830 |
Pricing | Inquire |
Cas | 1105067-87-5 |
Molecular Weight | 736.86 |
Molecular Formula | C40H48FN3O8?0.5Ca |
Canonical SMILES | CC(C)C1=C(C(=C(N1CCC(CC(CC(=O)NCCC(CC(CC(=O)[O-])O)O)O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4.CC(C)C1=C(C(=C(N1CCC(CC(CC(=O)NCCC(CC(CC(=O)[O-])O)O)O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4.[Ca+2] |