Zinc protoporphyrin IX
Zinc protoporphyrin IX is an endogenous metabolite formed during heme biosynthesis and a heme oxygenase inhibitor. Heme oxygenase is the enzyme producing CO, which is an activator of guanylyl cyclase and shares some chemical and biological properties of NO. Zinc protoporphyrin IX has been shown to inactivates the NOS isoforms nNOS, iNOS, and eNOS(IC50 = 0.8, 4, and 5 μM, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | 15442-64-5 |
| Pricing | Inquire |
| Cas | 15442-64-5 |
| Molecular Weight | 626.03 |
| Molecular Formula | C34H32N4O4Zn |
| Canonical SMILES | CC1=C(C2=CC3=C(C(=C([N-]3)C=C4C(=C(C(=N4)C=C5C(=C(C(=N5)C=C1[N-]2)C=C)C)C=C)C)C)CCC(=O)O)CCC(=O)O.[Zn+2] |