UDP-6-azido-6-deoxy-D-glucose
UDP-6-azido-6-deoxy-D-glucose is a vital compound used in biomedical field as a metabolic precursor for glycobiology research. It is commonly utilized in the synthesis of azidosugars, which are crucial for investigating glycoconjugates and understanding their roles in diseases like cancer and viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 537039-67-1 |
| Pricing | Inquire |
| Cas | 537039-67-1 |
| Molecular Weight | 591.31 |
| Molecular Formula | C15H23N5O16P2 |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OC3C(C(C(C(O3)CN=[N+]=[N-])O)O)O)O)O |