D-Melezitose hydrate
D-Melezitose hydrate, an extensively utilized carbohydrate derivative in the biomedical sector, exhibits substantial potential for treating an array of ailments, encompassing cancer and diabetes. Functioning as a potent pharmaceutical agent, it effectively hampers tumor proliferation while enhancing glucose metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 207511-10-2 |
| Pricing | Inquire |
| Cas | 207511-10-2 |
| Molecular Weight | 504.44 (anydrous basis) |
| Molecular Formula | C18H32O16 xH2O |
| Canonical SMILES | C(C1C(C(C(C(O1)OC2C(C(OC2(CO)OC3C(C(C(C(O3)CO)O)O)O)CO)O)O)O)O)O.O |