18:1 PE-Square Sodium salt
PE-Square is a type of phospholipid, specifically a phosphatidylethanolamine with a chemical structure where one of the fatty acid chains is attached to the phosphate group rather than the glycerol backbone. The sodium salt form of PE-Square refers to the salt form in which the phospholipid molecule has a sodium ion associated with it. This form of PE-Square may offer certain advantages in terms of solubility and stability in aqueous solutions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2315262-34-9 |
| Pricing | Inquire |
| Cas | 2315262-34-9 |
| Molecular Weight | 890.11 |
| Molecular Formula | C47H81NNaO11P |
| Canonical SMILES | [Na+].CCOC1=C(NCCOP([O-])(=O)OC[C@@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCCCC)C(=O)C1=O |