Progesterone Impurity A (Pregna-4,14-diene-3,20-dione)
An impurity of Progesterone.Progesterone is an endogenous steroid and progestogen sex hormone involved in the menstrual cycle, pregnancy, and embryogenesis of humans and other species. Progesterone is also a crucial metabolic intermediate in the production of other endogenous steroids, including the sex hormones and the corticosteroids, and plays an important role in brain function as a neurosteroid.
Supplier | BOC Sciences |
---|---|
Product # | 24377-08-0 |
Pricing | Inquire |
Cas | 24377-08-0 |
Molecular Weight | 312.46 |
Molecular Formula | C21H28O2 |
Canonical SMILES | CC(=O)C1CC=C2C1(CCC3C2CCC4=CC(=O)CCC34C)C |