Potassium 5-methyl-2-thiophene
Potassium 5-methyl-2-thiophene is utilized in the biomedical industry for its potential therapeutic applications. It is integrated into drugs aiming to treat various diseases, such as cancer, inflammation, and neurological disorders. Its molecular structure and properties make it an essential component in developing medications that combat these specific conditions effectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | 871231-40-2 |
| Pricing | Inquire |
| Cas | 871231-40-2 |
| Molecular Weight | 204.06 |
| Molecular Formula | CH3C4H2SBF3K |
| Canonical SMILES | [B-](C1=CC=C(S1)C)(F)(F)F.[K+] |