CYCLO(-HIS-PRO)
Cyclo(His-Pro), a diketopiperazine showing various biological effects in the CNS, as well as endocrine effects, has been isolated from several mammalian tissues. Cyclo(his-pro) could inhibit NF-κB nuclear accumulation. Cyclo(his-pro) can cross the brain-blood-barrier and affect diverse inflammatory and stress responses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 53109-32-3 |
| Pricing | Inquire |
| Cas | 53109-32-3 |
| Molecular Weight | 234.25 |
| Molecular Formula | C11H14N4O2 |
| Canonical SMILES | C1CC2C(=O)NC(C(=O)N2C1)CC3=CN=CN3 |