1,2-Diamino-4,5-dimethoxybenzene dihydrochloride
1,2-Diamino-4,5-dimethoxybenzene dihydrochloride reacts with aldehydes to produce highly fluorescent benzimidazole derivatives with excitation/emission spectra of 361/448 nm. It can be reacted with ketones and carbonyls to generate fluorescent adducts that can be separated and quantitated by reversed-phase HPLC.
| Supplier | BOC Sciences |
|---|---|
| Product # | 131076-14-7 |
| Pricing | Inquire |
| Cas | 131076-14-7 |
| Molecular Weight | 241.1 |
| Molecular Formula | C8H12N2O2ยท2HCl |
| Canonical SMILES | COC1=C(C=C(C(=C1)N)N)OC.Cl.Cl |