Dexamethasone EP Impurity G
The acetate-protect form of Dexamethasone which is a glucocorticoid and could be used as an anti-inflammatory agent. It can be used for various inflammations, allergic diseases, bovine ketoneemia, sheep pregnancy toxemia, and can also be used for the simultaneous delivery of female animals.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP3104 |
| Pricing | Inquire |
| Cas | 1177-87-3 |
| Molecular Weight | 434.50 |
| Molecular Formula | C24H31FO6 |
| Canonical SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COC(=O)C)O)C)O)F)C |