2',3'-Di-O-acetyl-4-N-benzoylcytidine
2',3'-Di-O-acetyl-4-N-benzoylcytidine is a potent antiviral precursor. With a primary function specifically aligned towards the inhibition of HIV-1 reverse transcriptase, it effectively acts as an impediment in the intricate labyrinth of the HIV replication process.
| Supplier | BOC Sciences |
|---|---|
| Product # | 99519-17-2 |
| Pricing | Inquire |
| Cas | 99519-17-2 |
| Molecular Weight | 431.40 |
| Molecular Formula | C20H21N3O8 |
| Canonical SMILES | CC(=O)OC1C(OC(C1OC(=O)C)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)CO |