Arphamenine B
Arphamenine B is a specific inhibitor of aminopeptidase B, which is first isolated from bacteria. Arphamenine B shares the same properties as the aminopeptidase inhibitors bestatin and amastatin, both of which enhance the immune response.
Supplier | BOC Sciences |
---|---|
Product # | 103900-19-2 |
Pricing | Inquire |
Cas | 103900-19-2 |
Molecular Weight | 336.39 |
Molecular Formula | C16H24N4O4 |
Canonical SMILES | O=C(O)C(CC(=O)C(N)CCCNC(=N)N)CC1=CC=C(O)C=C1 |