N-Acetyl Metoclopramide-[d3]
N-Acetyl Metoclopramide-[d3] is the labelled analogue of N-Acetyl Metoclopramide, which is a related compound of Metoclopramide. Metoclopramide is primarily used for stomach and esophageal problems by binding to the dopamine D2 receptors with nanomolar affinity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004874 |
| Pricing | Inquire |
| Cas | 105314-01-0 |
| Molecular Weight | 344.85 |
| Molecular Formula | C16H21D3ClN3O3 |
| Canonical SMILES | CCN(CC)CCNC(=O)C1=CC(=C(C=C1OC)NC(=O)C)Cl |