Urolithin B
Urolithin B is an urolithin that inhibits NF-κB activity by reducing the phosphorylation and degradation of IκBα. Urolithin B can be used for the treatment of muscle mass loss associated with various (pathological) physiological states.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1139-83-9 |
| Pricing | Inquire |
| Cas | 1139-83-9 |
| Molecular Weight | 212.2 |
| Molecular Formula | C13H8O3 |
| Canonical SMILES | C1=CC=C2C(=C1)C3=C(C=C(C=C3)O)OC2=O |