Ethyl 2-Chloro-2-nitroacetate
Ethyl 2-Chloro-2-nitroacetate is an intermediate in the synthesis of Chloronitromethane (C373930), a nitrogenous disinfection byproducts (N-DBPs) found in drinking water. Mutagenic in Salmonella and potent inducers of DNA strand breaks in mammalian cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB063290 |
| Pricing | Inquire |
| Cas | 14011-27-9 |
| Molecular Weight | 167.55 |
| Molecular Formula | C4H6ClNO4 |
| Canonical SMILES | CCOC(=O)C([N+](=O)[O-])Cl |