1-Aminofluorene
1-Aminofluorene (CAS# 6344-63-4) is an intermediate used in the synthesis of Fluoren-1-ol (F462450), which is a metabolite of the PAH micropollutant Fluorene (F462002) with potential mutagenic effects. It is used as biomarkers to evaluate exposure to PAHs and environmental tobacco smoke in general population. Photoluminescent dye.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6344-63-4 |
| Pricing | Inquire |
| Cas | 6344-63-4 |
| Molecular Weight | 181.23 |
| Molecular Formula | C13H11N |
| Canonical SMILES | C1C2=CC=CC=C2C3=C1C(=CC=C3)N |