NLCQ-1
NLCQ-1 is a novel weakly DNA-intercalative bioreductive compound. NLCQ-1 exhibited a C50 of 44 microM. NLCQ-1 demonstrated significant hypoxic selectivity in several rodent (V79, EMT6, SCCVII) or human (A549, OVCAR-3) tumor cell lines. Its potency as a hypoxic cytotoxin ranged between 10 and 136 microM x h, for the cell lines tested, at 30 microM input concentration. NLCQ-1 was a very potent and efficient radiosensitizer of hypoxic V79 cells, providing SER values of 2.27-2.56 at 20-80 microM concentration (measured at 10% survival level). Preclinical results suggest a possible use of NLCQ-1 as adjuvants to radiotherapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 221292-08-6 |
| Pricing | Inquire |
| Cas | 221292-08-6 |
| Molecular Weight | 368.22 |
| Molecular Formula | C15H15Cl2N5O2 |
| Canonical SMILES | C1=CC2=C(C=CN=C2C=C1Cl)NCCCN3C=CN=C3[N+](=O)[O-].Cl |