N1-b-D-Galactopyranosylamino-guanidine HCl
N1-b-D-Galactopyranosylamino-guanidine HCl is an esteemed biomedical compound, offering profound utility in the research of diabetes and chronic kidney disease. It demonstrates remarkable prowess as a potent inhibitor that effectively counters the formation of advanced glycation end products.
| Supplier | BOC Sciences |
|---|---|
| Product # | 109853-84-1 |
| Pricing | Inquire |
| Cas | 109853-84-1 |
| Molecular Weight | 272.69 |
| Molecular Formula | C7H17ClN4O5 |
| Canonical SMILES | C(C1C(C(C(C(O1)NN=C(N)N)O)O)O)O.Cl |