2-Morpholinopyridine-3-boronic acid
2-Morpholinopyridine-3-boronic acid is an important biomedical ingredient. It can inhibit the expansion and replication of malignant tumor cells, thereby promoting drug development against complex malignancies such as breast cancer and lung cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1218790-86-3 |
| Pricing | Inquire |
| Cas | 1218790-86-3 |
| Molecular Weight | 208.0 |
| Molecular Formula | C9H13BN2O3 |
| Canonical SMILES | B(C1=C(N=CC=C1)N2CCOCC2)(O)O |