4-O-(2-Acetamido-2-deoxy-b-D-glucopyranosyl)ribitol
4-O-(2-Acetamido-2-deoxy-b-D-glucopyranosyl)ribitol is a remarkable compound renowned for its potent antibacterial properties, used for research of bacterial infections. This remarkable compound has demonstrated extraordinary efficacy against a wide spectrum of Gram-positive bacteria, including the notoriously resilient methicillin-resistant strains of Staphylococcus aureus.
| Supplier | BOC Sciences |
|---|---|
| Product # | 21150-24-3 |
| Pricing | Inquire |
| Cas | 21150-24-3 |
| Molecular Weight | 355.34 |
| Molecular Formula | C13H25NO10 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC(CO)C(C(CO)O)O)CO)O)O |