DMABA NHS Ester
DMABA NHS ester is a reagent that reacts with the primary amine group of PE lipids. This facilitates the use of electrospray tandem mass spectrometry for the detection of diacyl, ether, and plasmalogen PE lipids that cannot be readily observed otherwise.
| Supplier | BOC Sciences |
|---|---|
| Product # | 58068-85-2 |
| Pricing | Inquire |
| Cas | 58068-85-2 |
| Molecular Weight | 262.26 |
| Molecular Formula | C13H14N2O4 |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=O)ON2C(=O)CCC2=O |