Vacquinol-1
Vacquinol-1, also known as NSC 13316, is an activator of MKK4-dependent macropinocytotic cell death in glioblastoma cells. In glioblastoma cells, Vacquinol-1 targets macropinocytosis, a cellular process that will not lead to cell death in normal cells. .
| Supplier | BOC Sciences |
|---|---|
| Product # | 5428-80-8 |
| Pricing | Inquire |
| Cas | 5428-80-8 |
| Molecular Weight | 352.86 |
| Molecular Formula | C21H21ClN2O |
| Canonical SMILES | ClC1=CC=C(C2=NC(C=CC=C3)=C3C(C(O)C4NCCCC4)=C2)C=C1 |