Ajugasterone C 2-acetate
Ajugasterone C 2-acetate is a prominent natural compound aiding in disease research such as cancer. Leveraging the remarkable attributes of its active constituent is ajugasterone C 2-acetate, this product effectively suppresses pathogenic factors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 154510-93-7 |
| Pricing | Inquire |
| Cas | 154510-93-7 |
| Molecular Weight | 522.68 |
| Molecular Formula | C29H46O8 |
| Canonical SMILES | CC(C)CCC(C(C)(C1CCC2(C1(CC(C3C2=CC(=O)C4C3(CC(C(C4)O)OC(=O)C)C)O)C)O)O)O |