5-methylaminomethyluridine
5-methylaminomethyluridine is a pharmaceutical compound widely used in the biomedical industry. It is primarily employed in the research of certain viral infections, such as hepatitis C and herpes. This compound exerts antiviral effects by inhibiting viral replication and promoting immune response.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72667-55-1 |
| Pricing | Inquire |
| Cas | 72667-55-1 |
| Molecular Weight | 287.27 |
| Molecular Formula | C11H17N3O6 |
| Canonical SMILES | CNCC1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O |