4-Fluorophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside
4-Fluorophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside, a compound of immense significance in the biomedical sphere, finds its purpose as a valuable instrument in the diligent exploration of prospective pharmaceuticals targeting a myriad of ailments. Its unconventional molecular configuration bestows upon it the distinctive ability to partake in the amalgamation of groundbreaking therapeutic agents, meticulously tailored to tackle distinct maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 135608-47-8 |
| Pricing | Inquire |
| Cas | 135608-47-8 |
| Molecular Weight | 315.29 |
| Molecular Formula | C14H18FNO6 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2=CC=C(C=C2)F)CO)O)O |