Ezetimibe Dehydoxy Impurity
An impurity of Ezetimibe. Ezetimibe inhibits intestinal cholesterol absorption by preventing cholesterol uptake by the Niemann-Pick C1-like 1 (NPC1L16) protein, a cholesterol transporter located in the apical membrane of enterocytes.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-471390 |
| Pricing | Inquire |
| Cas | 204589-58-2 |
| Molecular Weight | 393.44 |
| Molecular Formula | C24H21F2NO2 |
| Canonical SMILES | C1=CC(=CC=C1CCCC2C(N(C2=O)C3=CC=C(C=C3)F)C4=CC=C(C=C4)O)F |