Tropicamide-[d5]
Labelled Tropicamide. Tropicamide is a muscarinic acetylcholine receptor (mAChR) antagonist (pKi = 7.2 in chicken heart) that displays 3-fold selectivity for M4. When applied as eye drops, it produces temporary mydriasis (pupil dilation; EC50 = 6 µg/ml) and cycloplegia (ciliary muscle paralysis; EC50 = 25 µg/ml). Tropicamide has been used to probe mAChR activity in a mouse model of fragile X syndrome.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-007546 |
| Pricing | Inquire |
| Molecular Weight | 289.38 |
| Molecular Formula | C17H15D5N2O2 |
| Canonical SMILES | CCN(CC1=CC=NC=C1)C(=O)C(CO)C2=CC=CC=C2 |