2,3-O-Isopropylidene-2-C-methyl-D-ribono-1,4-lactone
2,3-O-Isopropylidene-2-C-methyl-D-ribono-1,4-lactone is a bio-medical concoction crucial to antiviral drug synthesis, serving as an indispensable cog in the intricate research of pharmaceutical arrays targeting pathologies instigated by RNA viruses, typified by influenza and hepatitis C.
| Supplier | BOC Sciences |
|---|---|
| Product # | 23709-41-3 |
| Pricing | Inquire |
| Cas | 23709-41-3 |
| Molecular Weight | 202.20 |
| Molecular Formula | C9H14O5 |
| Canonical SMILES | CC1(OC2C(OC(=O)C2(O1)C)CO)C |