Cyclosporin B
Cyclosporin B is a minor analogue of the cyclosporin complex produced by Trichoderma. An immunosuppressant that has revolutionized organ transplantation through its use in the prevention of graft rejection.
Supplier | BOC Sciences |
---|---|
Product # | B0052-074128 |
Pricing | 10 mg/unit USD $199 |
Cas | 63775-95-1 |
Molecular Weight | 1188.58 |
Molecular Formula | C61H109N11O12 |
Canonical SMILES | CC=CCC(C)C(C1C(=O)NC(C(=O)N(CC(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N1C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C)C)O |