5'-Phosphoryl-(3'-amino-3'-deoxyguanylyl)-(3'-5')-3'-amino-3'-deoxycytidine
5'-Phosphoryl-(3'-amino-3'-deoxyguanylyl)-(3'-5')-3'-amino-3'-deoxycytidine is a highly significant compound extensively employed in the biomedical sector, holding immense therapeutic potential for research of viral infections. Moreover, this remarkable compound exhibits auspicious outcomes in impeding the proliferation of neoplastic cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 109679-54-1 |
| Pricing | Inquire |
| Cas | 109679-54-1 |
| Molecular Weight | 666.43 |
| Molecular Formula | C19H28N10O13P2 |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COCC3C(C(C(O3)N4C=NC5=C4N=C(NC5=O)N)N)OP(=O)(O)O)OP(=O)(O)O)N |