Prednisolone 21-Sulfate Sodium Salt
Prednisolone 21-Sulfate is a metabolite of Prednisolone, which is a synthetic glucocorticoid, a derivative of cortisol, and can be used to treat a variety of inflammatory and auto-immune conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3664-95-7 |
| Pricing | Inquire |
| Cas | 3664-95-7 |
| Molecular Weight | 462.49 |
| Molecular Formula | C21H27NaO8S |
| Canonical SMILES | CC12CC(C3C(C1CCC2(C(=O)COS(=O)(=O)[O-])O)CCC4=CC(=O)C=CC34C)O.[Na+] |